C33H21Cl2NO3 — CID 4892317
1-(2-chlorobenzoyl)-2-(3-chlorophenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione (PubChem CID 4892317) has the molecular formula C33H21Cl2NO3 and a molecular weight of 550.44 g/mol. Its IUPAC name is 1-(2-chlorobenzoyl)-2-(3-chlorophenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione.
| Compound Name | 1-(2-chlorobenzoyl)-2-(3-chlorophenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
|---|---|
| PubChem CID | 4892317 |
| Molecular Formula | C33H21Cl2NO3 |
| Molecular Weight | 550.44 g/mol |
| Exact Mass | 549.09 |
| IUPAC Name | 1-(2-chlorobenzoyl)-2-(3-chlorophenyl)spiro[2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-3,2'-indene]-1',3'-dione |
| SMILES | O=C(c1ccccc1Cl)C1C(c2cccc(Cl)c2)C2(C(=O)c3ccccc3C2=O)C2C=Cc3ccccc3N12 |
| InChI | InChI=1S/C33H21Cl2NO3/c34-21-10-7-9-20(18-21)28-29(30(37)24-13-4-5-14-25(24)35)36-26-15-6-1-8-19(26)16-17-27(36)33(28)31(38)22-11-2-3-12-23(22)32(33)39/h1-18,27-29H |
| InChIKey | HUYDVBWGAUHZOX-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.44 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|