C21H19ClN2O5S — CID 4892538
4-[(8-chloro-16-oxo-6,17-dioxa-4-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-4-yl)methyl]benzenesulfonamide (PubChem CID 4892538) has the molecular formula C21H19ClN2O5S and a molecular weight of 446.91 g/mol. Its IUPAC name is 4-[(8-chloro-16-oxo-6,17-dioxa-4-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-4-yl)methyl]benzenesulfonamide.
| Compound Name | 4-[(8-chloro-16-oxo-6,17-dioxa-4-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-4-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4892538 |
| Molecular Formula | C21H19ClN2O5S |
| Molecular Weight | 446.91 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 4-[(8-chloro-16-oxo-6,17-dioxa-4-azatetracyclo[8.7.0.02,7.011,15]heptadeca-1,7,9,11(15)-tetraen-4-yl)methyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CN2COc3c(Cl)cc4c5c(c(=O)oc4c3C2)CCC5)cc1 |
| InChI | InChI=1S/C21H19ClN2O5S/c22-18-8-16-14-2-1-3-15(14)21(25)29-19(16)17-10-24(11-28-20(17)18)9-12-4-6-13(7-5-12)30(23,26)27/h4-8H,1-3,9-11H2,(H2,23,26,27) |
| InChIKey | PCENORCHWVPLIJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.91 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|