C25H23N5O4 — CID 4893007
ethyl 4-(2-aminophenyl)-13-(4-methoxyphenyl)-11-methyl-10-oxa-3,5,6,8-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,11-pentaene-12-carboxylate (PubChem CID 4893007) has the molecular formula C25H23N5O4 and a molecular weight of 457.49 g/mol. Its IUPAC name is ethyl 4-(2-aminophenyl)-13-(4-methoxyphenyl)-11-methyl-10-oxa-3,5,6,8-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,11-pentaene-12-carboxylate.
| Compound Name | ethyl 4-(2-aminophenyl)-13-(4-methoxyphenyl)-11-methyl-10-oxa-3,5,6,8-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,11-pentaene-12-carboxylate |
|---|---|
| PubChem CID | 4893007 |
| Molecular Formula | C25H23N5O4 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | ethyl 4-(2-aminophenyl)-13-(4-methoxyphenyl)-11-methyl-10-oxa-3,5,6,8-tetrazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,11-pentaene-12-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Oc2ncn3nc(-c4ccccc4N)nc3c2C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H23N5O4/c1-4-33-25(31)19-14(2)34-24-21(20(19)15-9-11-16(32-3)12-10-15)23-28-22(29-30(23)13-27-24)17-7-5-6-8-18(17)26/h5-13,20H,4,26H2,1-3H3 |
| InChIKey | PUTVWXNVNBBIGY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 113.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|