About 7-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxy-2-(trifluoromethyl)quinoline
7-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxy-2-(trifluoromethyl)quinoline (PubChem CID 48932196) has the molecular formula C16H10F3N5O
and a molecular weight of 345.28 g/mol. Its IUPAC name is 7-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxy-2-(trifluoromethyl)quinoline.
Molecular Properties
| Compound Name | 7-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxy-2-(trifluoromethyl)quinoline |
| PubChem CID | 48932196 |
| Molecular Formula | C16H10F3N5O |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 7-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxy-2-(trifluoromethyl)quinoline |
| SMILES | Cn1ncc2c(Oc3ccc4ccc(C(F)(F)F)nc4c3)ncnc21 |
| InChI | InChI=1S/C16H10F3N5O/c1-24-14-11(7-22-24)15(21-8-20-14)25-10-4-2-9-3-5-13(16(17,18)19)23-12(9)6-10/h2-8H,1H3 |
| InChIKey | YXIHGZIQZCFUFU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxy-2-(trifluoromethyl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxy-2-(trifluoromethyl)quinoline?
The IUPAC name of 7-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxy-2-(trifluoromethyl)quinoline (CID 48932196) is 7-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxy-2-(trifluoromethyl)quinoline.
What is the SMILES notation for 7-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxy-2-(trifluoromethyl)quinoline?
The canonical SMILES for 7-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxy-2-(trifluoromethyl)quinoline is Cn1ncc2c(Oc3ccc4ccc(C(F)(F)F)nc4c3)ncnc21.
What is the InChIKey of 7-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxy-2-(trifluoromethyl)quinoline?
The InChIKey is YXIHGZIQZCFUFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10F3N5O/c1-24-14-11(7-22-24)15(21-8-20-14)25-10-4-2-9-3-5-13(16(17,18)19)23-12(9)6-10/h2-8H,1H3.
What are the key properties of 7-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxy-2-(trifluoromethyl)quinoline?
7-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxy-2-(trifluoromethyl)quinoline has a molecular weight of 345.28 g/mol, XLogP of 3.72, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)oxy-2-(trifluoromethyl)quinoline is sourced from PubChem (CID 48932196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).