C19H14ClNO6 — CID 4894470
2-[[2-[(2-chlorophenoxy)methyl]furan-3-carbonyl]amino]-5-hydroxybenzoic acid (PubChem CID 4894470) has the molecular formula C19H14ClNO6 and a molecular weight of 387.78 g/mol. Its IUPAC name is 2-[[2-[(2-chlorophenoxy)methyl]furan-3-carbonyl]amino]-5-hydroxybenzoic acid.
| Compound Name | 2-[[2-[(2-chlorophenoxy)methyl]furan-3-carbonyl]amino]-5-hydroxybenzoic acid |
|---|---|
| PubChem CID | 4894470 |
| Molecular Formula | C19H14ClNO6 |
| Molecular Weight | 387.78 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 2-[[2-[(2-chlorophenoxy)methyl]furan-3-carbonyl]amino]-5-hydroxybenzoic acid |
| SMILES | O=C(O)c1cc(O)ccc1NC(=O)c1ccoc1COc1ccccc1Cl |
| InChI | InChI=1S/C19H14ClNO6/c20-14-3-1-2-4-16(14)27-10-17-12(7-8-26-17)18(23)21-15-6-5-11(22)9-13(15)19(24)25/h1-9,22H,10H2,(H,21,23)(H,24,25) |
| InChIKey | JCOQUQNTFPWZLH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.78 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_acid_F(2)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|