About N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]propane-1-sulfonamide
N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]propane-1-sulfonamide (PubChem CID 48946622) has the molecular formula C8H18N2O4S2
and a molecular weight of 270.38 g/mol. Its IUPAC name is N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]propane-1-sulfonamide.
Molecular Properties
| Compound Name | N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]propane-1-sulfonamide |
| PubChem CID | 48946622 |
| Molecular Formula | C8H18N2O4S2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NCCN1CCCS1(=O)=O |
| InChI | InChI=1S/C8H18N2O4S2/c1-2-7-15(11,12)9-4-6-10-5-3-8-16(10,13)14/h9H,2-8H2,1H3 |
| InChIKey | POGJXZMFMSUNEA-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]propane-1-sulfonamide?
The IUPAC name of N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]propane-1-sulfonamide (CID 48946622) is N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]propane-1-sulfonamide.
What is the SMILES notation for N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]propane-1-sulfonamide?
The canonical SMILES for N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]propane-1-sulfonamide is CCCS(=O)(=O)NCCN1CCCS1(=O)=O.
What is the InChIKey of N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]propane-1-sulfonamide?
The InChIKey is POGJXZMFMSUNEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O4S2/c1-2-7-15(11,12)9-4-6-10-5-3-8-16(10,13)14/h9H,2-8H2,1H3.
What are the key properties of N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]propane-1-sulfonamide?
N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]propane-1-sulfonamide has a molecular weight of 270.38 g/mol, XLogP of -0.65, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]propane-1-sulfonamide is sourced from PubChem (CID 48946622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).