About 2-[2-(dimethylsulfamoylamino)ethyl]-1,1-dioxo-1,2-thiazolidine
2-[2-(dimethylsulfamoylamino)ethyl]-1,1-dioxo-1,2-thiazolidine (PubChem CID 48946734) has the molecular formula C7H17N3O4S2
and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-[2-(dimethylsulfamoylamino)ethyl]-1,1-dioxo-1,2-thiazolidine.
Molecular Properties
| Compound Name | 2-[2-(dimethylsulfamoylamino)ethyl]-1,1-dioxo-1,2-thiazolidine |
| PubChem CID | 48946734 |
| Molecular Formula | C7H17N3O4S2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 2-[2-(dimethylsulfamoylamino)ethyl]-1,1-dioxo-1,2-thiazolidine |
| SMILES | CN(C)S(=O)(=O)NCCN1CCCS1(=O)=O |
| InChI | InChI=1S/C7H17N3O4S2/c1-9(2)16(13,14)8-4-6-10-5-3-7-15(10,11)12/h8H,3-7H2,1-2H3 |
| InChIKey | KTIPMIDIOFDLGS-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(dimethylsulfamoylamino)ethyl]-1,1-dioxo-1,2-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(dimethylsulfamoylamino)ethyl]-1,1-dioxo-1,2-thiazolidine?
The IUPAC name of 2-[2-(dimethylsulfamoylamino)ethyl]-1,1-dioxo-1,2-thiazolidine (CID 48946734) is 2-[2-(dimethylsulfamoylamino)ethyl]-1,1-dioxo-1,2-thiazolidine.
What is the SMILES notation for 2-[2-(dimethylsulfamoylamino)ethyl]-1,1-dioxo-1,2-thiazolidine?
The canonical SMILES for 2-[2-(dimethylsulfamoylamino)ethyl]-1,1-dioxo-1,2-thiazolidine is CN(C)S(=O)(=O)NCCN1CCCS1(=O)=O.
What is the InChIKey of 2-[2-(dimethylsulfamoylamino)ethyl]-1,1-dioxo-1,2-thiazolidine?
The InChIKey is KTIPMIDIOFDLGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17N3O4S2/c1-9(2)16(13,14)8-4-6-10-5-3-7-15(10,11)12/h8H,3-7H2,1-2H3.
What are the key properties of 2-[2-(dimethylsulfamoylamino)ethyl]-1,1-dioxo-1,2-thiazolidine?
2-[2-(dimethylsulfamoylamino)ethyl]-1,1-dioxo-1,2-thiazolidine has a molecular weight of 271.36 g/mol, XLogP of -1.58, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(dimethylsulfamoylamino)ethyl]-1,1-dioxo-1,2-thiazolidine is sourced from PubChem (CID 48946734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).