C23H18N2O5 — CID 4895033
3-(2,3-dimethoxyphenyl)-5-naphthalen-2-yl-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 4895033) has the molecular formula C23H18N2O5 and a molecular weight of 402.41 g/mol. Its IUPAC name is 3-(2,3-dimethoxyphenyl)-5-naphthalen-2-yl-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | 3-(2,3-dimethoxyphenyl)-5-naphthalen-2-yl-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 4895033 |
| Molecular Formula | C23H18N2O5 |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 3-(2,3-dimethoxyphenyl)-5-naphthalen-2-yl-3a,6a-dihydropyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | COc1cccc(C2=NOC3C(=O)N(c4ccc5ccccc5c4)C(=O)C23)c1OC |
| InChI | InChI=1S/C23H18N2O5/c1-28-17-9-5-8-16(20(17)29-2)19-18-21(30-24-19)23(27)25(22(18)26)15-11-10-13-6-3-4-7-14(13)12-15/h3-12,18,21H,1-2H3 |
| InChIKey | ZHPZIJMAENJLMF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|