C18H30N6O3 — CID 48958130
3-N-ethyl-1-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]piperidine-1,3-dicarboxamide (PubChem CID 48958130) has the molecular formula C18H30N6O3 and a molecular weight of 378.48 g/mol. Its IUPAC name is 3-N-ethyl-1-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]piperidine-1,3-dicarboxamide.
| Compound Name | 3-N-ethyl-1-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 48958130 |
| Molecular Formula | C18H30N6O3 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 3-N-ethyl-1-N-[3-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]piperidine-1,3-dicarboxamide |
| SMILES | CCNC(=O)C1CCCN(C(=O)NCCCn2nc3n(c2=O)CCCC3)C1 |
| InChI | InChI=1S/C18H30N6O3/c1-2-19-16(25)14-7-5-10-22(13-14)17(26)20-9-6-12-24-18(27)23-11-4-3-8-15(23)21-24/h14H,2-13H2,1H3,(H,19,25)(H,20,26) |
| InChIKey | YUHUOWMMLMZPKS-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|