C17H18N4O4 — CID 4896364
2,3-dimethyl-7-[(3,4,5-trimethoxyphenyl)methylidene]imidazo[1,2-b][1,2,4]triazin-6-one (PubChem CID 4896364) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is 2,3-dimethyl-7-[(3,4,5-trimethoxyphenyl)methylidene]imidazo[1,2-b][1,2,4]triazin-6-one.
| Compound Name | 2,3-dimethyl-7-[(3,4,5-trimethoxyphenyl)methylidene]imidazo[1,2-b][1,2,4]triazin-6-one |
|---|---|
| PubChem CID | 4896364 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2,3-dimethyl-7-[(3,4,5-trimethoxyphenyl)methylidene]imidazo[1,2-b][1,2,4]triazin-6-one |
| SMILES | COc1cc(C=C2C(=O)N=C3N=C(C)C(C)=NN23)cc(OC)c1OC |
| InChI | InChI=1S/C17H18N4O4/c1-9-10(2)20-21-12(16(22)19-17(21)18-9)6-11-7-13(23-3)15(25-5)14(8-11)24-4/h6-8H,1-5H3 |
| InChIKey | PXSFYPCFHZBYCR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 85.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|