C18H21N3O2 — CID 4896393
14-(3-methylbutyl)-17-oxa-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12-pentaen-15-one (PubChem CID 4896393) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 14-(3-methylbutyl)-17-oxa-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12-pentaen-15-one.
| Compound Name | 14-(3-methylbutyl)-17-oxa-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12-pentaen-15-one |
|---|---|
| PubChem CID | 4896393 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 14-(3-methylbutyl)-17-oxa-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),2,8,11(16),12-pentaen-15-one |
| SMILES | CC(C)CCn1cnc2c(oc3nc4c(cc32)CCCC4)c1=O |
| InChI | InChI=1S/C18H21N3O2/c1-11(2)7-8-21-10-19-15-13-9-12-5-3-4-6-14(12)20-17(13)23-16(15)18(21)22/h9-11H,3-8H2,1-2H3 |
| InChIKey | XXDGXRKCWRAWRC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |