C18H18BrNO4 — CID 4896529
3-(5-bromofuran-2-yl)-1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)prop-2-en-1-one (PubChem CID 4896529) has the molecular formula C18H18BrNO4 and a molecular weight of 392.25 g/mol. Its IUPAC name is 3-(5-bromofuran-2-yl)-1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)prop-2-en-1-one.
| Compound Name | 3-(5-bromofuran-2-yl)-1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4896529 |
| Molecular Formula | C18H18BrNO4 |
| Molecular Weight | 392.25 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 3-(5-bromofuran-2-yl)-1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)prop-2-en-1-one |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)C=Cc1ccc(Br)o1)CC2 |
| InChI | InChI=1S/C18H18BrNO4/c1-22-15-9-12-7-8-20(11-13(12)10-16(15)23-2)18(21)6-4-14-3-5-17(19)24-14/h3-6,9-10H,7-8,11H2,1-2H3 |
| InChIKey | TUDMLIRMLWNXSY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.25 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|