C20H23ClN4O4 — CID 4896646
2-(5-tert-butyl-5'-chloro-7'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl)acetamide (PubChem CID 4896646) has the molecular formula C20H23ClN4O4 and a molecular weight of 418.88 g/mol. Its IUPAC name is 2-(5-tert-butyl-5'-chloro-7'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl)acetamide.
| Compound Name | 2-(5-tert-butyl-5'-chloro-7'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl)acetamide |
|---|---|
| PubChem CID | 4896646 |
| Molecular Formula | C20H23ClN4O4 |
| Molecular Weight | 418.88 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2-(5-tert-butyl-5'-chloro-7'-methyl-2',4,6-trioxospiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-1-yl)acetamide |
| SMILES | Cc1cc(Cl)cc2c1NC(=O)C21NC(CC(N)=O)C2C(=O)N(C(C)(C)C)C(=O)C21 |
| InChI | InChI=1S/C20H23ClN4O4/c1-8-5-9(21)6-10-15(8)23-18(29)20(10)14-13(11(24-20)7-12(22)26)16(27)25(17(14)28)19(2,3)4/h5-6,11,13-14,24H,7H2,1-4H3,(H2,22,26)(H,23,29) |
| InChIKey | TXPUQMXCQOSVCS-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.88 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|