C20H15N5O2 — CID 4897145
6-amino-4-(3,4-dihydroxyphenyl)-3-methyl-1-phenylpyrazolo[5,4-b]pyridine-5-carbonitrile (PubChem CID 4897145) has the molecular formula C20H15N5O2 and a molecular weight of 357.37 g/mol. Its IUPAC name is 6-amino-4-(3,4-dihydroxyphenyl)-3-methyl-1-phenylpyrazolo[5,4-b]pyridine-5-carbonitrile.
| Compound Name | 6-amino-4-(3,4-dihydroxyphenyl)-3-methyl-1-phenylpyrazolo[5,4-b]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 4897145 |
| Molecular Formula | C20H15N5O2 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 6-amino-4-(3,4-dihydroxyphenyl)-3-methyl-1-phenylpyrazolo[5,4-b]pyridine-5-carbonitrile |
| SMILES | Cc1nn(-c2ccccc2)c2nc(N)c(C#N)c(-c3ccc(O)c(O)c3)c12 |
| InChI | InChI=1S/C20H15N5O2/c1-11-17-18(12-7-8-15(26)16(27)9-12)14(10-21)19(22)23-20(17)25(24-11)13-5-3-2-4-6-13/h2-9,26-27H,1H3,(H2,22,23) |
| InChIKey | FMRRVKMKGQZGRP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|