C17H14ClN5S — CID 4897322
4-(2-chlorophenyl)-13-methyl-10-thia-3,5,6,8,13-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene (PubChem CID 4897322) has the molecular formula C17H14ClN5S and a molecular weight of 355.85 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-13-methyl-10-thia-3,5,6,8,13-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene.
| Compound Name | 4-(2-chlorophenyl)-13-methyl-10-thia-3,5,6,8,13-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
|---|---|
| PubChem CID | 4897322 |
| Molecular Formula | C17H14ClN5S |
| Molecular Weight | 355.85 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | 4-(2-chlorophenyl)-13-methyl-10-thia-3,5,6,8,13-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaene |
| SMILES | CN1CCc2c(sc3ncn4nc(-c5ccccc5Cl)nc4c23)C1 |
| InChI | InChI=1S/C17H14ClN5S/c1-22-7-6-11-13(8-22)24-17-14(11)16-20-15(21-23(16)9-19-17)10-4-2-3-5-12(10)18/h2-5,9H,6-8H2,1H3 |
| InChIKey | BFTKEBYLKKKCNF-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.85 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |