C21H20ClN3O3 — CID 4897544
N-(5-chloro-2-cyanophenyl)-2-(2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinolin-8-yl)acetamide (PubChem CID 4897544) has the molecular formula C21H20ClN3O3 and a molecular weight of 397.86 g/mol. Its IUPAC name is N-(5-chloro-2-cyanophenyl)-2-(2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinolin-8-yl)acetamide.
| Compound Name | N-(5-chloro-2-cyanophenyl)-2-(2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinolin-8-yl)acetamide |
|---|---|
| PubChem CID | 4897544 |
| Molecular Formula | C21H20ClN3O3 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | N-(5-chloro-2-cyanophenyl)-2-(2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinolin-8-yl)acetamide |
| SMILES | N#Cc1ccc(Cl)cc1NC(=O)CN1CCc2cc3c(cc2C1)OCCCO3 |
| InChI | InChI=1S/C21H20ClN3O3/c22-17-3-2-15(11-23)18(10-17)24-21(26)13-25-5-4-14-8-19-20(9-16(14)12-25)28-7-1-6-27-19/h2-3,8-10H,1,4-7,12-13H2,(H,24,26) |
| InChIKey | CUGVLKJNILOWGH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |