C21H26N2O2 — CID 48982884
N-[1-(2,5-dimethylphenyl)ethyl]-2-morpholin-4-ylbenzamide (PubChem CID 48982884) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is N-[1-(2,5-dimethylphenyl)ethyl]-2-morpholin-4-ylbenzamide.
| Compound Name | N-[1-(2,5-dimethylphenyl)ethyl]-2-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 48982884 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N-[1-(2,5-dimethylphenyl)ethyl]-2-morpholin-4-ylbenzamide |
| SMILES | Cc1ccc(C)c(C(C)NC(=O)c2ccccc2N2CCOCC2)c1 |
| InChI | InChI=1S/C21H26N2O2/c1-15-8-9-16(2)19(14-15)17(3)22-21(24)18-6-4-5-7-20(18)23-10-12-25-13-11-23/h4-9,14,17H,10-13H2,1-3H3,(H,22,24) |
| InChIKey | XYBUPMSGFLFKGZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |