About N-(6-fluoro-1,3-benzothiazol-2-yl)-5,7-dimethyl-4-oxochromene-2-carboxamide
N-(6-fluoro-1,3-benzothiazol-2-yl)-5,7-dimethyl-4-oxochromene-2-carboxamide (PubChem CID 4898416) has the molecular formula C19H13FN2O3S
and a molecular weight of 368.39 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-5,7-dimethyl-4-oxochromene-2-carboxamide.
Molecular Properties
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-5,7-dimethyl-4-oxochromene-2-carboxamide |
| PubChem CID | 4898416 |
| Molecular Formula | C19H13FN2O3S |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-5,7-dimethyl-4-oxochromene-2-carboxamide |
| SMILES | Cc1cc(C)c2c(=O)cc(C(=O)Nc3nc4ccc(F)cc4s3)oc2c1 |
| InChI | InChI=1S/C19H13FN2O3S/c1-9-5-10(2)17-13(23)8-15(25-14(17)6-9)18(24)22-19-21-12-4-3-11(20)7-16(12)26-19/h3-8H,1-2H3,(H,21,22,24) |
| InChIKey | CUNHRGPROPEHDD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(6-fluoro-1,3-benzothiazol-2-yl)-5,7-dimethyl-4-oxochromene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-fluoro-1,3-benzothiazol-2-yl)-5,7-dimethyl-4-oxochromene-2-carboxamide?
The IUPAC name of N-(6-fluoro-1,3-benzothiazol-2-yl)-5,7-dimethyl-4-oxochromene-2-carboxamide (CID 4898416) is N-(6-fluoro-1,3-benzothiazol-2-yl)-5,7-dimethyl-4-oxochromene-2-carboxamide.
What is the SMILES notation for N-(6-fluoro-1,3-benzothiazol-2-yl)-5,7-dimethyl-4-oxochromene-2-carboxamide?
The canonical SMILES for N-(6-fluoro-1,3-benzothiazol-2-yl)-5,7-dimethyl-4-oxochromene-2-carboxamide is Cc1cc(C)c2c(=O)cc(C(=O)Nc3nc4ccc(F)cc4s3)oc2c1.
What is the InChIKey of N-(6-fluoro-1,3-benzothiazol-2-yl)-5,7-dimethyl-4-oxochromene-2-carboxamide?
The InChIKey is CUNHRGPROPEHDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13FN2O3S/c1-9-5-10(2)17-13(23)8-15(25-14(17)6-9)18(24)22-19-21-12-4-3-11(20)7-16(12)26-19/h3-8H,1-2H3,(H,21,22,24).
What are the key properties of N-(6-fluoro-1,3-benzothiazol-2-yl)-5,7-dimethyl-4-oxochromene-2-carboxamide?
N-(6-fluoro-1,3-benzothiazol-2-yl)-5,7-dimethyl-4-oxochromene-2-carboxamide has a molecular weight of 368.39 g/mol, XLogP of 4.41, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-fluoro-1,3-benzothiazol-2-yl)-5,7-dimethyl-4-oxochromene-2-carboxamide is sourced from PubChem (CID 4898416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).