C24H22BrN3O3 — CID 4898556
2'-(4-bromophenyl)-6,7-dimethylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione (PubChem CID 4898556) has the molecular formula C24H22BrN3O3 and a molecular weight of 480.36 g/mol. Its IUPAC name is 2'-(4-bromophenyl)-6,7-dimethylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione.
| Compound Name | 2'-(4-bromophenyl)-6,7-dimethylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
|---|---|
| PubChem CID | 4898556 |
| Molecular Formula | C24H22BrN3O3 |
| Molecular Weight | 480.36 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 2'-(4-bromophenyl)-6,7-dimethylspiro[1H-indole-3,4'-3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine]-1',2,3'-trione |
| SMILES | Cc1ccc2c(c1C)NC(=O)C21C2C(=O)N(c3ccc(Br)cc3)C(=O)C2C2CCCN21 |
| InChI | InChI=1S/C24H22BrN3O3/c1-12-5-10-16-20(13(12)2)26-23(31)24(16)19-18(17-4-3-11-27(17)24)21(29)28(22(19)30)15-8-6-14(25)7-9-15/h5-10,17-19H,3-4,11H2,1-2H3,(H,26,31) |
| InChIKey | PRRWLDXLXLNPFY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|