About N-(1-adamantyl)-4,5,6-trimethoxy-1H-indole-2-carboxamide
N-(1-adamantyl)-4,5,6-trimethoxy-1H-indole-2-carboxamide (PubChem CID 4898756) has the molecular formula C22H28N2O4
and a molecular weight of 384.48 g/mol. Its IUPAC name is N-(1-adamantyl)-4,5,6-trimethoxy-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | N-(1-adamantyl)-4,5,6-trimethoxy-1H-indole-2-carboxamide |
| PubChem CID | 4898756 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-(1-adamantyl)-4,5,6-trimethoxy-1H-indole-2-carboxamide |
| SMILES | COc1cc2[nH]c(C(=O)NC34CC5CC(CC(C5)C3)C4)cc2c(OC)c1OC |
| InChI | InChI=1S/C22H28N2O4/c1-26-18-8-16-15(19(27-2)20(18)28-3)7-17(23-16)21(25)24-22-9-12-4-13(10-22)6-14(5-12)11-22/h7-8,12-14,23H,4-6,9-11H2,1-3H3,(H,24,25) |
| InChIKey | PHTLCBGHHJUBNH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1-adamantyl)-4,5,6-trimethoxy-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-adamantyl)-4,5,6-trimethoxy-1H-indole-2-carboxamide?
The IUPAC name of N-(1-adamantyl)-4,5,6-trimethoxy-1H-indole-2-carboxamide (CID 4898756) is N-(1-adamantyl)-4,5,6-trimethoxy-1H-indole-2-carboxamide.
What is the SMILES notation for N-(1-adamantyl)-4,5,6-trimethoxy-1H-indole-2-carboxamide?
The canonical SMILES for N-(1-adamantyl)-4,5,6-trimethoxy-1H-indole-2-carboxamide is COc1cc2[nH]c(C(=O)NC34CC5CC(CC(C5)C3)C4)cc2c(OC)c1OC.
What is the InChIKey of N-(1-adamantyl)-4,5,6-trimethoxy-1H-indole-2-carboxamide?
The InChIKey is PHTLCBGHHJUBNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28N2O4/c1-26-18-8-16-15(19(27-2)20(18)28-3)7-17(23-16)21(25)24-22-9-12-4-13(10-22)6-14(5-12)11-22/h7-8,12-14,23H,4-6,9-11H2,1-3H3,(H,24,25).
What are the key properties of N-(1-adamantyl)-4,5,6-trimethoxy-1H-indole-2-carboxamide?
N-(1-adamantyl)-4,5,6-trimethoxy-1H-indole-2-carboxamide has a molecular weight of 384.48 g/mol, XLogP of 3.89, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-adamantyl)-4,5,6-trimethoxy-1H-indole-2-carboxamide is sourced from PubChem (CID 4898756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).