C13H15N3O4S — CID 4898872
N-(3,4-dihydro-1H-[1,4]oxazino[4,3-a]benzimidazol-8-yl)-N-methyl-1-methylsulfonylformamide (PubChem CID 4898872) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is N-(3,4-dihydro-1H-[1,4]oxazino[4,3-a]benzimidazol-8-yl)-N-methyl-1-methylsulfonylformamide.
| Compound Name | N-(3,4-dihydro-1H-[1,4]oxazino[4,3-a]benzimidazol-8-yl)-N-methyl-1-methylsulfonylformamide |
|---|---|
| PubChem CID | 4898872 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | N-(3,4-dihydro-1H-[1,4]oxazino[4,3-a]benzimidazol-8-yl)-N-methyl-1-methylsulfonylformamide |
| SMILES | CN(C(=O)S(C)(=O)=O)c1ccc2c(c1)nc1n2CCOC1 |
| InChI | InChI=1S/C13H15N3O4S/c1-15(13(17)21(2,18)19)9-3-4-11-10(7-9)14-12-8-20-6-5-16(11)12/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | GDNJFORVKYPJTQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|