C21H27N3O4 — CID 4898976
5-butan-2-yl-1-(1-hydroxyethyl)-5',7'-dimethylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione (PubChem CID 4898976) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 5-butan-2-yl-1-(1-hydroxyethyl)-5',7'-dimethylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione.
| Compound Name | 5-butan-2-yl-1-(1-hydroxyethyl)-5',7'-dimethylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
|---|---|
| PubChem CID | 4898976 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 5-butan-2-yl-1-(1-hydroxyethyl)-5',7'-dimethylspiro[1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3,3'-1H-indole]-2',4,6-trione |
| SMILES | CCC(C)N1C(=O)C2C(C(C)O)NC3(C(=O)Nc4c(C)cc(C)cc43)C2C1=O |
| InChI | InChI=1S/C21H27N3O4/c1-6-11(4)24-18(26)14-15(19(24)27)21(23-17(14)12(5)25)13-8-9(2)7-10(3)16(13)22-20(21)28/h7-8,11-12,14-15,17,23,25H,6H2,1-5H3,(H,22,28) |
| InChIKey | GLQWAEUHRDMSMP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|