C19H20N4OS — CID 4899293
2-ethylsulfanyl-9-(2-phenylethenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 4899293) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is 2-ethylsulfanyl-9-(2-phenylethenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-ethylsulfanyl-9-(2-phenylethenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 4899293 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-ethylsulfanyl-9-(2-phenylethenyl)-5,6,7,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCSc1nc2n(n1)C(C=Cc1ccccc1)C1=C(CCCC1=O)N2 |
| InChI | InChI=1S/C19H20N4OS/c1-2-25-19-21-18-20-14-9-6-10-16(24)17(14)15(23(18)22-19)12-11-13-7-4-3-5-8-13/h3-5,7-8,11-12,15H,2,6,9-10H2,1H3,(H,20,21,22) |
| InChIKey | MGJOHRNXXHDLSB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |