C22H21N5O3 — CID 4899345
2-[1-(11,12-dimethyl-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)-2-methylbutyl]isoindole-1,3-dione (PubChem CID 4899345) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 2-[1-(11,12-dimethyl-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)-2-methylbutyl]isoindole-1,3-dione.
| Compound Name | 2-[1-(11,12-dimethyl-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)-2-methylbutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 4899345 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 2-[1-(11,12-dimethyl-10-oxa-3,5,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-4-yl)-2-methylbutyl]isoindole-1,3-dione |
| SMILES | CCC(C)C(c1nc2c3c(C)c(C)oc3ncn2n1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C22H21N5O3/c1-5-11(2)17(27-21(28)14-8-6-7-9-15(14)22(27)29)18-24-19-16-12(3)13(4)30-20(16)23-10-26(19)25-18/h6-11,17H,5H2,1-4H3 |
| InChIKey | FQCTZMVUMFSBIF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 93.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|