C20H27N5 — CID 4899869
N-(7-benzyl-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 4899869) has the molecular formula C20H27N5 and a molecular weight of 337.47 g/mol. Its IUPAC name is N-(7-benzyl-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(7-benzyl-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 4899869 |
| Molecular Formula | C20H27N5 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | N-(7-benzyl-5,6-dimethylpyrrolo[2,3-d]pyrimidin-4-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2ncnc(NCCCN(C)C)c12 |
| InChI | InChI=1S/C20H27N5/c1-15-16(2)25(13-17-9-6-5-7-10-17)20-18(15)19(22-14-23-20)21-11-8-12-24(3)4/h5-7,9-10,14H,8,11-13H2,1-4H3,(H,21,22,23) |
| InChIKey | PKMCPYVDVCAJRT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|