C19H16ClN5 — CID 4900052
[3-(4-chlorophenyl)-2-methyl-5-phenylpyrazolo[1,5-a]pyrimidin-7-yl]hydrazine (PubChem CID 4900052) has the molecular formula C19H16ClN5 and a molecular weight of 349.83 g/mol. Its IUPAC name is [3-(4-chlorophenyl)-2-methyl-5-phenylpyrazolo[1,5-a]pyrimidin-7-yl]hydrazine.
| Compound Name | [3-(4-chlorophenyl)-2-methyl-5-phenylpyrazolo[1,5-a]pyrimidin-7-yl]hydrazine |
|---|---|
| PubChem CID | 4900052 |
| Molecular Formula | C19H16ClN5 |
| Molecular Weight | 349.83 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | [3-(4-chlorophenyl)-2-methyl-5-phenylpyrazolo[1,5-a]pyrimidin-7-yl]hydrazine |
| SMILES | Cc1nn2c(NN)cc(-c3ccccc3)nc2c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16ClN5/c1-12-18(14-7-9-15(20)10-8-14)19-22-16(13-5-3-2-4-6-13)11-17(23-21)25(19)24-12/h2-11,23H,21H2,1H3 |
| InChIKey | VUNPVDCVHVONIB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.83 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|