C20H21F3N2O2S — CID 49005408
N-[3-(thiomorpholin-4-ylmethyl)phenyl]-4-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 49005408) has the molecular formula C20H21F3N2O2S and a molecular weight of 410.46 g/mol. Its IUPAC name is N-[3-(thiomorpholin-4-ylmethyl)phenyl]-4-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | N-[3-(thiomorpholin-4-ylmethyl)phenyl]-4-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 49005408 |
| Molecular Formula | C20H21F3N2O2S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | N-[3-(thiomorpholin-4-ylmethyl)phenyl]-4-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | O=C(Nc1cccc(CN2CCSCC2)c1)c1ccc(OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H21F3N2O2S/c21-20(22,23)14-27-18-6-4-16(5-7-18)19(26)24-17-3-1-2-15(12-17)13-25-8-10-28-11-9-25/h1-7,12H,8-11,13-14H2,(H,24,26) |
| InChIKey | BZHLOTUUGCTHIN-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |