C21H26N2O3S — CID 4900845
6-(7,7-dimethyl-2-phenyl-4-sulfanylidene-5,8-dihydropyrano[4,3-d]pyrimidin-1-yl)hexanoic acid (PubChem CID 4900845) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is 6-(7,7-dimethyl-2-phenyl-4-sulfanylidene-5,8-dihydropyrano[4,3-d]pyrimidin-1-yl)hexanoic acid.
| Compound Name | 6-(7,7-dimethyl-2-phenyl-4-sulfanylidene-5,8-dihydropyrano[4,3-d]pyrimidin-1-yl)hexanoic acid |
|---|---|
| PubChem CID | 4900845 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 6-(7,7-dimethyl-2-phenyl-4-sulfanylidene-5,8-dihydropyrano[4,3-d]pyrimidin-1-yl)hexanoic acid |
| SMILES | CC1(C)Cc2c(c(=S)nc(-c3ccccc3)n2CCCCCC(=O)O)CO1 |
| InChI | InChI=1S/C21H26N2O3S/c1-21(2)13-17-16(14-26-21)20(27)22-19(15-9-5-3-6-10-15)23(17)12-8-4-7-11-18(24)25/h3,5-6,9-10H,4,7-8,11-14H2,1-2H3,(H,24,25) |
| InChIKey | ATIUXAHPGDUPTL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|