C15H23N3O2S — CID 4901367
7-morpholin-4-yl-6-pentyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one (PubChem CID 4901367) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 7-morpholin-4-yl-6-pentyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one.
| Compound Name | 7-morpholin-4-yl-6-pentyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 4901367 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 7-morpholin-4-yl-6-pentyl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidin-5-one |
| SMILES | CCCCCc1c(N2CCOCC2)nc2n(c1=O)CCS2 |
| InChI | InChI=1S/C15H23N3O2S/c1-2-3-4-5-12-13(17-6-9-20-10-7-17)16-15-18(14(12)19)8-11-21-15/h2-11H2,1H3 |
| InChIKey | YZZIBASUWPZNDS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|