C24H25FN2O5 — CID 4901422
2-(4-fluorophenyl)-3-[3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-1-(3-morpholin-4-ylpropyl)-2H-pyrrol-5-one (PubChem CID 4901422) has the molecular formula C24H25FN2O5 and a molecular weight of 440.47 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-[3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-1-(3-morpholin-4-ylpropyl)-2H-pyrrol-5-one.
| Compound Name | 2-(4-fluorophenyl)-3-[3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-1-(3-morpholin-4-ylpropyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4901422 |
| Molecular Formula | C24H25FN2O5 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 2-(4-fluorophenyl)-3-[3-(furan-2-yl)prop-2-enoyl]-4-hydroxy-1-(3-morpholin-4-ylpropyl)-2H-pyrrol-5-one |
| SMILES | O=C(C=Cc1ccco1)C1=C(O)C(=O)N(CCCN2CCOCC2)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C24H25FN2O5/c25-18-6-4-17(5-7-18)22-21(20(28)9-8-19-3-1-14-32-19)23(29)24(30)27(22)11-2-10-26-12-15-31-16-13-26/h1,3-9,14,22,29H,2,10-13,15-16H2 |
| InChIKey | STLHGIRBDJQKQC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|