C18H22N4O — CID 4901525
3-[[5,6-dimethyl-7-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]propan-1-ol (PubChem CID 4901525) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 3-[[5,6-dimethyl-7-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]propan-1-ol.
| Compound Name | 3-[[5,6-dimethyl-7-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 4901525 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 3-[[5,6-dimethyl-7-(4-methylphenyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]propan-1-ol |
| SMILES | Cc1ccc(-n2c(C)c(C)c3c(NCCCO)ncnc32)cc1 |
| InChI | InChI=1S/C18H22N4O/c1-12-5-7-15(8-6-12)22-14(3)13(2)16-17(19-9-4-10-23)20-11-21-18(16)22/h5-8,11,23H,4,9-10H2,1-3H3,(H,19,20,21) |
| InChIKey | CHERTLSAXXMERD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|