About 2-(2,4-dimethylphenyl)-N-prop-2-ynyl-1,3-thiazole-5-carboxamide
2-(2,4-dimethylphenyl)-N-prop-2-ynyl-1,3-thiazole-5-carboxamide (PubChem CID 49015979) has the molecular formula C15H14N2OS
and a molecular weight of 270.36 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-N-prop-2-ynyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-(2,4-dimethylphenyl)-N-prop-2-ynyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 49015979 |
| Molecular Formula | C15H14N2OS |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-N-prop-2-ynyl-1,3-thiazole-5-carboxamide |
| SMILES | C#CCNC(=O)c1cnc(-c2ccc(C)cc2C)s1 |
| InChI | InChI=1S/C15H14N2OS/c1-4-7-16-14(18)13-9-17-15(19-13)12-6-5-10(2)8-11(12)3/h1,5-6,8-9H,7H2,2-3H3,(H,16,18) |
| InChIKey | WSFRSUUQUUIVMT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dimethylphenyl)-N-prop-2-ynyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethylphenyl)-N-prop-2-ynyl-1,3-thiazole-5-carboxamide?
The IUPAC name of 2-(2,4-dimethylphenyl)-N-prop-2-ynyl-1,3-thiazole-5-carboxamide (CID 49015979) is 2-(2,4-dimethylphenyl)-N-prop-2-ynyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2-(2,4-dimethylphenyl)-N-prop-2-ynyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2-(2,4-dimethylphenyl)-N-prop-2-ynyl-1,3-thiazole-5-carboxamide is C#CCNC(=O)c1cnc(-c2ccc(C)cc2C)s1.
What is the InChIKey of 2-(2,4-dimethylphenyl)-N-prop-2-ynyl-1,3-thiazole-5-carboxamide?
The InChIKey is WSFRSUUQUUIVMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2OS/c1-4-7-16-14(18)13-9-17-15(19-13)12-6-5-10(2)8-11(12)3/h1,5-6,8-9H,7H2,2-3H3,(H,16,18).
What are the key properties of 2-(2,4-dimethylphenyl)-N-prop-2-ynyl-1,3-thiazole-5-carboxamide?
2-(2,4-dimethylphenyl)-N-prop-2-ynyl-1,3-thiazole-5-carboxamide has a molecular weight of 270.36 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethylphenyl)-N-prop-2-ynyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 49015979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).