C24H23ClN4O4 — CID 4901914
2-chloro-N-(1,3-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-7'-yl)benzamide (PubChem CID 4901914) has the molecular formula C24H23ClN4O4 and a molecular weight of 466.93 g/mol. Its IUPAC name is 2-chloro-N-(1,3-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-7'-yl)benzamide.
| Compound Name | 2-chloro-N-(1,3-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-7'-yl)benzamide |
|---|---|
| PubChem CID | 4901914 |
| Molecular Formula | C24H23ClN4O4 |
| Molecular Weight | 466.93 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 2-chloro-N-(1,3-dimethyl-2,4,6-trioxospiro[1,3-diazinane-5,4'-2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline]-7'-yl)benzamide |
| SMILES | CN1C(=O)N(C)C(=O)C2(Cc3cc(NC(=O)c4ccccc4Cl)ccc3N3CCCC32)C1=O |
| InChI | InChI=1S/C24H23ClN4O4/c1-27-21(31)24(22(32)28(2)23(27)33)13-14-12-15(9-10-18(14)29-11-5-8-19(24)29)26-20(30)16-6-3-4-7-17(16)25/h3-4,6-7,9-10,12,19H,5,8,11,13H2,1-2H3,(H,26,30) |
| InChIKey | PSJYUHXTLLVPJW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.93 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|