C28H36N6O2S — CID 4902115
2-[(7-anilino-8-cyano-11,11-dimethyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-5-yl)sulfanyl]-N,N-dibutylacetamide (PubChem CID 4902115) has the molecular formula C28H36N6O2S and a molecular weight of 520.70 g/mol. Its IUPAC name is 2-[(7-anilino-8-cyano-11,11-dimethyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-5-yl)sulfanyl]-N,N-dibutylacetamide.
| Compound Name | 2-[(7-anilino-8-cyano-11,11-dimethyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-5-yl)sulfanyl]-N,N-dibutylacetamide |
|---|---|
| PubChem CID | 4902115 |
| Molecular Formula | C28H36N6O2S |
| Molecular Weight | 520.70 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | 2-[(7-anilino-8-cyano-11,11-dimethyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-5-yl)sulfanyl]-N,N-dibutylacetamide |
| SMILES | CCCCN(CCCC)C(=O)CSc1nnc2c3c(c(C#N)c(Nc4ccccc4)n12)CC(C)(C)OC3 |
| InChI | InChI=1S/C28H36N6O2S/c1-5-7-14-33(15-8-6-2)24(35)19-37-27-32-31-26-23-18-36-28(3,4)16-21(23)22(17-29)25(34(26)27)30-20-12-10-9-11-13-20/h9-13,30H,5-8,14-16,18-19H2,1-4H3 |
| InChIKey | BUYWKMPXLDOJSZ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 95.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.70 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |