C18H17ClN2O5S — CID 4902604
1-[2-[5-[(3-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]piperidine-4-carboxylic acid (PubChem CID 4902604) has the molecular formula C18H17ClN2O5S and a molecular weight of 408.86 g/mol. Its IUPAC name is 1-[2-[5-[(3-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-[5-[(3-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 4902604 |
| Molecular Formula | C18H17ClN2O5S |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 1-[2-[5-[(3-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(C(=O)CN2C(=O)SC(=Cc3cccc(Cl)c3)C2=O)CC1 |
| InChI | InChI=1S/C18H17ClN2O5S/c19-13-3-1-2-11(8-13)9-14-16(23)21(18(26)27-14)10-15(22)20-6-4-12(5-7-20)17(24)25/h1-3,8-9,12H,4-7,10H2,(H,24,25) |
| InChIKey | IBPKTLSEOPMCQJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|