C20H21N5OS — CID 4902841
7-anilino-5-ethylsulfanyl-11,11-dimethyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile (PubChem CID 4902841) has the molecular formula C20H21N5OS and a molecular weight of 379.49 g/mol. Its IUPAC name is 7-anilino-5-ethylsulfanyl-11,11-dimethyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile.
| Compound Name | 7-anilino-5-ethylsulfanyl-11,11-dimethyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
|---|---|
| PubChem CID | 4902841 |
| Molecular Formula | C20H21N5OS |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 7-anilino-5-ethylsulfanyl-11,11-dimethyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
| SMILES | CCSc1nnc2c3c(c(C#N)c(Nc4ccccc4)n12)CC(C)(C)OC3 |
| InChI | InChI=1S/C20H21N5OS/c1-4-27-19-24-23-18-16-12-26-20(2,3)10-14(16)15(11-21)17(25(18)19)22-13-8-6-5-7-9-13/h5-9,22H,4,10,12H2,1-3H3 |
| InChIKey | KRSAAQUYKKMZGQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 75.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |