C20H17Cl2N5O3S — CID 4903003
2-[2-[4-(3,5-dichlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]ethyl]-7,8-dimethoxyphthalazin-1-one (PubChem CID 4903003) has the molecular formula C20H17Cl2N5O3S and a molecular weight of 478.36 g/mol. Its IUPAC name is 2-[2-[4-(3,5-dichlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]ethyl]-7,8-dimethoxyphthalazin-1-one.
| Compound Name | 2-[2-[4-(3,5-dichlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]ethyl]-7,8-dimethoxyphthalazin-1-one |
|---|---|
| PubChem CID | 4903003 |
| Molecular Formula | C20H17Cl2N5O3S |
| Molecular Weight | 478.36 g/mol |
| Exact Mass | 477.04 |
| IUPAC Name | 2-[2-[4-(3,5-dichlorophenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]ethyl]-7,8-dimethoxyphthalazin-1-one |
| SMILES | COc1ccc2cnn(CCc3n[nH]c(=S)n3-c3cc(Cl)cc(Cl)c3)c(=O)c2c1OC |
| InChI | InChI=1S/C20H17Cl2N5O3S/c1-29-15-4-3-11-10-23-26(19(28)17(11)18(15)30-2)6-5-16-24-25-20(31)27(16)14-8-12(21)7-13(22)9-14/h3-4,7-10H,5-6H2,1-2H3,(H,25,31) |
| InChIKey | RJFZXYUKVZRVNT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.36 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|