C21H21N5O4S — CID 4903046
7,8-dimethoxy-2-[2-[4-(2-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]ethyl]phthalazin-1-one (PubChem CID 4903046) has the molecular formula C21H21N5O4S and a molecular weight of 439.50 g/mol. Its IUPAC name is 7,8-dimethoxy-2-[2-[4-(2-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]ethyl]phthalazin-1-one.
| Compound Name | 7,8-dimethoxy-2-[2-[4-(2-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]ethyl]phthalazin-1-one |
|---|---|
| PubChem CID | 4903046 |
| Molecular Formula | C21H21N5O4S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 7,8-dimethoxy-2-[2-[4-(2-methoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-3-yl]ethyl]phthalazin-1-one |
| SMILES | COc1ccccc1-n1c(CCn2ncc3ccc(OC)c(OC)c3c2=O)n[nH]c1=S |
| InChI | InChI=1S/C21H21N5O4S/c1-28-15-7-5-4-6-14(15)26-17(23-24-21(26)31)10-11-25-20(27)18-13(12-22-25)8-9-16(29-2)19(18)30-3/h4-9,12H,10-11H2,1-3H3,(H,24,31) |
| InChIKey | MOIFKTSDLUDXGF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 96.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|