C20H15ClN6O2 — CID 4903192
10-(2-chlorophenyl)-4-(3,4-dimethoxyphenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 4903192) has the molecular formula C20H15ClN6O2 and a molecular weight of 406.83 g/mol. Its IUPAC name is 10-(2-chlorophenyl)-4-(3,4-dimethoxyphenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 10-(2-chlorophenyl)-4-(3,4-dimethoxyphenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 4903192 |
| Molecular Formula | C20H15ClN6O2 |
| Molecular Weight | 406.83 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 10-(2-chlorophenyl)-4-(3,4-dimethoxyphenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | COc1ccc(-c2nc3c4cnn(-c5ccccc5Cl)c4ncn3n2)cc1OC |
| InChI | InChI=1S/C20H15ClN6O2/c1-28-16-8-7-12(9-17(16)29-2)18-24-20-13-10-23-27(15-6-4-3-5-14(15)21)19(13)22-11-26(20)25-18/h3-11H,1-2H3 |
| InChIKey | FWIDLXWGIDLXIL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 79.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.83 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |