C19H23N5O3 — CID 49032784
2-(3-methyl-4-oxophthalazin-1-yl)-N-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]acetamide (PubChem CID 49032784) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is 2-(3-methyl-4-oxophthalazin-1-yl)-N-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]acetamide.
| Compound Name | 2-(3-methyl-4-oxophthalazin-1-yl)-N-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]acetamide |
|---|---|
| PubChem CID | 49032784 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 2-(3-methyl-4-oxophthalazin-1-yl)-N-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]acetamide |
| SMILES | CC(C)c1noc(CCCNC(=O)Cc2nn(C)c(=O)c3ccccc23)n1 |
| InChI | InChI=1S/C19H23N5O3/c1-12(2)18-21-17(27-23-18)9-6-10-20-16(25)11-15-13-7-4-5-8-14(13)19(26)24(3)22-15/h4-5,7-8,12H,6,9-11H2,1-3H3,(H,20,25) |
| InChIKey | VATXTNHZNGCFBB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|