C26H25N5OS — CID 4904166
7-anilino-11,11-dimethyl-5-(2-phenylethylsulfanyl)-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile (PubChem CID 4904166) has the molecular formula C26H25N5OS and a molecular weight of 455.59 g/mol. Its IUPAC name is 7-anilino-11,11-dimethyl-5-(2-phenylethylsulfanyl)-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile.
| Compound Name | 7-anilino-11,11-dimethyl-5-(2-phenylethylsulfanyl)-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
|---|---|
| PubChem CID | 4904166 |
| Molecular Formula | C26H25N5OS |
| Molecular Weight | 455.59 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 7-anilino-11,11-dimethyl-5-(2-phenylethylsulfanyl)-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraene-8-carbonitrile |
| SMILES | CC1(C)Cc2c(C#N)c(Nc3ccccc3)n3c(SCCc4ccccc4)nnc3c2CO1 |
| InChI | InChI=1S/C26H25N5OS/c1-26(2)15-20-21(16-27)23(28-19-11-7-4-8-12-19)31-24(22(20)17-32-26)29-30-25(31)33-14-13-18-9-5-3-6-10-18/h3-12,28H,13-15,17H2,1-2H3 |
| InChIKey | BTDLZBSNCHVOFE-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 75.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.59 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |