C21H21N3O4 — CID 4904308
N-(3-acetylphenyl)-2-(2,4-dioxo-1H-quinazolin-3-yl)-3-methylbutanamide (PubChem CID 4904308) has the molecular formula C21H21N3O4 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-(2,4-dioxo-1H-quinazolin-3-yl)-3-methylbutanamide.
| Compound Name | N-(3-acetylphenyl)-2-(2,4-dioxo-1H-quinazolin-3-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 4904308 |
| Molecular Formula | C21H21N3O4 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-(3-acetylphenyl)-2-(2,4-dioxo-1H-quinazolin-3-yl)-3-methylbutanamide |
| SMILES | CC(=O)c1cccc(NC(=O)C(C(C)C)n2c(=O)[nH]c3ccccc3c2=O)c1 |
| InChI | InChI=1S/C21H21N3O4/c1-12(2)18(19(26)22-15-8-6-7-14(11-15)13(3)25)24-20(27)16-9-4-5-10-17(16)23-21(24)28/h4-12,18H,1-3H3,(H,22,26)(H,23,28) |
| InChIKey | YVLYGMFTTPCDHM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |