C19H22N4O2 — CID 49046049
N-[[6-(benzimidazol-1-yl)-3-pyridinyl]methyl]-4-ethoxybutanamide (PubChem CID 49046049) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[[6-(benzimidazol-1-yl)-3-pyridinyl]methyl]-4-ethoxybutanamide.
| Compound Name | N-[[6-(benzimidazol-1-yl)-3-pyridinyl]methyl]-4-ethoxybutanamide |
|---|---|
| PubChem CID | 49046049 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | N-[[6-(benzimidazol-1-yl)-3-pyridinyl]methyl]-4-ethoxybutanamide |
| SMILES | CCOCCCC(=O)NCc1ccc(-n2cnc3ccccc32)nc1 |
| InChI | InChI=1S/C19H22N4O2/c1-2-25-11-5-8-19(24)21-13-15-9-10-18(20-12-15)23-14-22-16-6-3-4-7-17(16)23/h3-4,6-7,9-10,12,14H,2,5,8,11,13H2,1H3,(H,21,24) |
| InChIKey | CLKMFBYIXOQZDZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|