C17H14N2O5 — CID 4905308
3-methyl-N-(2-nitrophenyl)-1-oxo-4H-isochromene-3-carboxamide (PubChem CID 4905308) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is 3-methyl-N-(2-nitrophenyl)-1-oxo-4H-isochromene-3-carboxamide.
| Compound Name | 3-methyl-N-(2-nitrophenyl)-1-oxo-4H-isochromene-3-carboxamide |
|---|---|
| PubChem CID | 4905308 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 3-methyl-N-(2-nitrophenyl)-1-oxo-4H-isochromene-3-carboxamide |
| SMILES | CC1(C(=O)Nc2ccccc2[N+](=O)[O-])Cc2ccccc2C(=O)O1 |
| InChI | InChI=1S/C17H14N2O5/c1-17(10-11-6-2-3-7-12(11)15(20)24-17)16(21)18-13-8-4-5-9-14(13)19(22)23/h2-9H,10H2,1H3,(H,18,21) |
| InChIKey | GGMBSYLROKYTFY-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|