C21H28N4O2S — CID 4905757
6-cyclohexyl-1-[2-(2-methoxyphenyl)ethyl]-2-sulfanylidene-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-4-one (PubChem CID 4905757) has the molecular formula C21H28N4O2S and a molecular weight of 400.55 g/mol. Its IUPAC name is 6-cyclohexyl-1-[2-(2-methoxyphenyl)ethyl]-2-sulfanylidene-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-4-one.
| Compound Name | 6-cyclohexyl-1-[2-(2-methoxyphenyl)ethyl]-2-sulfanylidene-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4905757 |
| Molecular Formula | C21H28N4O2S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 6-cyclohexyl-1-[2-(2-methoxyphenyl)ethyl]-2-sulfanylidene-7,8-dihydro-5H-pyrimido[4,5-d]pyrimidin-4-one |
| SMILES | COc1ccccc1CCn1c2c(c(=O)[nH]c1=S)CN(C1CCCCC1)CN2 |
| InChI | InChI=1S/C21H28N4O2S/c1-27-18-10-6-5-7-15(18)11-12-25-19-17(20(26)23-21(25)28)13-24(14-22-19)16-8-3-2-4-9-16/h5-7,10,16,22H,2-4,8-9,11-14H2,1H3,(H,23,26,28) |
| InChIKey | ILTGKLRSGWLPSL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 62.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|