C20H15N3O2S — CID 4905932
5-oxo-7-(4-phenylmethoxyphenyl)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile (PubChem CID 4905932) has the molecular formula C20H15N3O2S and a molecular weight of 361.43 g/mol. Its IUPAC name is 5-oxo-7-(4-phenylmethoxyphenyl)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile.
| Compound Name | 5-oxo-7-(4-phenylmethoxyphenyl)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile |
|---|---|
| PubChem CID | 4905932 |
| Molecular Formula | C20H15N3O2S |
| Molecular Weight | 361.43 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 5-oxo-7-(4-phenylmethoxyphenyl)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyrimidine-6-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(OCc3ccccc3)cc2)nc2n(c1=O)CCS2 |
| InChI | InChI=1S/C20H15N3O2S/c21-12-17-18(22-20-23(19(17)24)10-11-26-20)15-6-8-16(9-7-15)25-13-14-4-2-1-3-5-14/h1-9H,10-11,13H2 |
| InChIKey | LONUNNLFFXXCQD-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|