C15H13Cl2N3O — CID 49061963
1-(4,5-dichloro-1H-indole-2-carbonyl)piperidine-4-carbonitrile (PubChem CID 49061963) has the molecular formula C15H13Cl2N3O and a molecular weight of 322.20 g/mol. Its IUPAC name is 1-(4,5-dichloro-1H-indole-2-carbonyl)piperidine-4-carbonitrile.
| Compound Name | 1-(4,5-dichloro-1H-indole-2-carbonyl)piperidine-4-carbonitrile |
|---|---|
| PubChem CID | 49061963 |
| Molecular Formula | C15H13Cl2N3O |
| Molecular Weight | 322.20 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 1-(4,5-dichloro-1H-indole-2-carbonyl)piperidine-4-carbonitrile |
| SMILES | N#CC1CCN(C(=O)c2cc3c(Cl)c(Cl)ccc3[nH]2)CC1 |
| InChI | InChI=1S/C15H13Cl2N3O/c16-11-1-2-12-10(14(11)17)7-13(19-12)15(21)20-5-3-9(8-18)4-6-20/h1-2,7,9,19H,3-6H2 |
| InChIKey | CIWGAFVHFDEEAY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.20 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |