C28H26N6O3S — CID 4906554
N-(4-acetylphenyl)-2-[(7-anilino-8-cyano-11,11-dimethyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-5-yl)sulfanyl]acetamide (PubChem CID 4906554) has the molecular formula C28H26N6O3S and a molecular weight of 526.62 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-[(7-anilino-8-cyano-11,11-dimethyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-5-yl)sulfanyl]acetamide.
| Compound Name | N-(4-acetylphenyl)-2-[(7-anilino-8-cyano-11,11-dimethyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-5-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 4906554 |
| Molecular Formula | C28H26N6O3S |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 526.18 |
| IUPAC Name | N-(4-acetylphenyl)-2-[(7-anilino-8-cyano-11,11-dimethyl-12-oxa-3,4,6-triazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-5-yl)sulfanyl]acetamide |
| SMILES | CC(=O)c1ccc(NC(=O)CSc2nnc3c4c(c(C#N)c(Nc5ccccc5)n23)CC(C)(C)OC4)cc1 |
| InChI | InChI=1S/C28H26N6O3S/c1-17(35)18-9-11-20(12-10-18)30-24(36)16-38-27-33-32-26-23-15-37-28(2,3)13-21(23)22(14-29)25(34(26)27)31-19-7-5-4-6-8-19/h4-12,31H,13,15-16H2,1-3H3,(H,30,36) |
| InChIKey | HLTGJMREMRYORF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |