C24H18N4O4 — CID 4906893
1-benzyl-2-hydroxy-3-[(4-nitrophenyl)methyl]pyrimido[1,2-a]benzimidazol-4-one (PubChem CID 4906893) has the molecular formula C24H18N4O4 and a molecular weight of 426.43 g/mol. Its IUPAC name is 1-benzyl-2-hydroxy-3-[(4-nitrophenyl)methyl]pyrimido[1,2-a]benzimidazol-4-one.
| Compound Name | 1-benzyl-2-hydroxy-3-[(4-nitrophenyl)methyl]pyrimido[1,2-a]benzimidazol-4-one |
|---|---|
| PubChem CID | 4906893 |
| Molecular Formula | C24H18N4O4 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 1-benzyl-2-hydroxy-3-[(4-nitrophenyl)methyl]pyrimido[1,2-a]benzimidazol-4-one |
| SMILES | O=c1c(Cc2ccc([N+](=O)[O-])cc2)c(O)n(Cc2ccccc2)c2nc3ccccc3n12 |
| InChI | InChI=1S/C24H18N4O4/c29-22-19(14-16-10-12-18(13-11-16)28(31)32)23(30)27-21-9-5-4-8-20(21)25-24(27)26(22)15-17-6-2-1-3-7-17/h1-13,29H,14-15H2 |
| InChIKey | VCXKNHJYYOJOAY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|