About 1-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylsulfonylpropan-1-one
1-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylsulfonylpropan-1-one (PubChem CID 49070293) has the molecular formula C10H18F2N2O3S
and a molecular weight of 284.33 g/mol. Its IUPAC name is 1-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylsulfonylpropan-1-one.
Molecular Properties
| Compound Name | 1-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylsulfonylpropan-1-one |
| PubChem CID | 49070293 |
| Molecular Formula | C10H18F2N2O3S |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylsulfonylpropan-1-one |
| SMILES | CC(C(=O)N1CCN(CC(F)F)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C10H18F2N2O3S/c1-8(18(2,16)17)10(15)14-5-3-13(4-6-14)7-9(11)12/h8-9H,3-7H2,1-2H3 |
| InChIKey | JRRBYALEMVUPIF-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylsulfonylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylsulfonylpropan-1-one?
The IUPAC name of 1-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylsulfonylpropan-1-one (CID 49070293) is 1-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylsulfonylpropan-1-one.
What is the SMILES notation for 1-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylsulfonylpropan-1-one?
The canonical SMILES for 1-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylsulfonylpropan-1-one is CC(C(=O)N1CCN(CC(F)F)CC1)S(C)(=O)=O.
What is the InChIKey of 1-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylsulfonylpropan-1-one?
The InChIKey is JRRBYALEMVUPIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2N2O3S/c1-8(18(2,16)17)10(15)14-5-3-13(4-6-14)7-9(11)12/h8-9H,3-7H2,1-2H3.
What are the key properties of 1-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylsulfonylpropan-1-one?
1-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylsulfonylpropan-1-one has a molecular weight of 284.33 g/mol, XLogP of -0.17, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(2,2-difluoroethyl)piperazin-1-yl]-2-methylsulfonylpropan-1-one is sourced from PubChem (CID 49070293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).